ChemNet > CAS > 881-07-2 8-Nitroquinaldine
881-07-2 8-Nitroquinaldine
Produkt-Name |
8-Nitroquinaldine |
Synonyme |
Nitroquinaldine; 2-Methyl-8-nitroquinoline |
Molekulare Formel |
C10H8N2O2 |
Molecular Weight |
188.1827 |
InChI |
InChI=1/C10H8N2O2/c1-7-5-6-8-3-2-4-9(12(13)14)10(8)11-7/h2-6H,1H3 |
CAS Registry Number |
881-07-2 |
EINECS |
212-919-6 |
Molecular Structure |
|
Dichte |
1.298g/cm3 |
Siedepunkt |
323.8°C at 760 mmHg |
Brechungsindex |
1.661 |
Flammpunkt |
149.6°C |
Gefahrensymbole |
|
Risk Codes |
R40:Possible risks of irreversible effects.;
|
Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|