ChemNet > CAS > 921-53-9 L(+)tartaric acid dipotassium
921-53-9 L(+)tartaric acid dipotassium
| Produkt-Name |
L(+)tartaric acid dipotassium |
| Synonyme |
dipotassium tartrate; L-Tartaric acid dipotassium salt; potassium tartrate |
| Molekulare Formel |
K2C4H4O6 |
| Molecular Weight |
226.266 |
| InChI |
InChI=1/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2/t1-,2-;;/m1../s1 |
| CAS Registry Number |
921-53-9 |
| EINECS |
213-067-8 |
| Molecular Structure |
|
| Dichte |
1.98 |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
