ChemNet > CAS > 942-92-7 Hexanophenone
942-92-7 Hexanophenone
| Produkt-Name |
Hexanophenone |
| Synonyme |
n-Amyl phenyl ketone; Phenyl n-pentyl ketone; Amyl phenyl ketone; 1-phenylhexan-1-one |
| Molekulare Formel |
C12H16O |
| Molecular Weight |
176.2548 |
| InChI |
InChI=1/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| CAS Registry Number |
942-92-7 |
| EINECS |
213-394-6 |
| Molecular Structure |
|
| Dichte |
0.942g/cm3 |
| Schmelzpunkt |
25-26℃ |
| Siedepunkt |
265°C at 760 mmHg |
| Brechungsindex |
1.498 |
| Flammpunkt |
105.5°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
