CAS No: 95111-49-2, Chemical Name: 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one
the physical and chemical property of 95111-49-2, 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one is provided by ChemNet.com
ChemNet > CAS > 95111-49-2 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one
95111-49-2 2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one
| Produkt-Name |
2,3,5,6-Tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dien-1-one |
| Synonyme |
2,5-cyclohexadien-1-one, 2,3,5,6-tetrabromo-4-methyl-4-nitro-; 2,3,5,6-tetrabromo-4-methyl-4-nitrocyclohexa-2,5-dienone |
| Molekulare Formel |
C7H3Br4NO3 |
| Molecular Weight |
468.7196 |
| InChI |
InChI=1/C7H3Br4NO3/c1-7(12(14)15)5(10)2(8)4(13)3(9)6(7)11/h1H3 |
| CAS Registry Number |
95111-49-2 |
| Molecular Structure |
|
| Dichte |
2.66g/cm3 |
| Siedepunkt |
466.3°C at 760 mmHg |
| Brechungsindex |
1.706 |
| Flammpunkt |
235.8°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
