ChemNet > CAS > 95727-77-8 2,6-Difluorobutyrophenone
95727-77-8 2,6-Difluorobutyrophenone
Produkt-Name |
2,6-Difluorobutyrophenone |
Synonyme |
1-(2,6-difluorophenyl)butan-1-one |
Molekulare Formel |
C10H10F2O |
Molecular Weight |
184.1826 |
InChI |
InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
CAS Registry Number |
95727-77-8 |
Molecular Structure |
|
Dichte |
1.134g/cm3 |
Siedepunkt |
219.6°C at 760 mmHg |
Brechungsindex |
1.472 |
Flammpunkt |
82.6°C |
Gefahrensymbole |
|
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|