ChemNet > CAS > 10036-64-3 2-Acetamido-2-deoxy-Alpha-D-glucopyranose
10036-64-3 2-Acetamido-2-deoxy-Alpha-D-glucopyranose
| product Name |
2-Acetamido-2-deoxy-Alpha-D-glucopyranose |
| Synonyms |
N-Acetyl-alpha-D-glucosamine; AcetylDglucosamine; 2-(acetylamino)-2-deoxyhexopyranose; 2-(acetylamino)-2-deoxy-D-glucose; 2-(acetylamino)-2-deoxy-beta-L-talopyranose |
| Molecular Formula |
C8H15NO6 |
| Molecular Weight |
221.2078 |
| InChI |
InChI=1/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5+,6+,7-,8-/m0/s1 |
| CAS Registry Number |
10036-64-3 |
| EINECS |
233-115-1 |
| Molecular Structure |
|
| Density |
1.506g/cm3 |
| Melting point |
211℃ |
| Boiling point |
595.353°C at 760 mmHg |
| Refractive index |
1.576 |
| Flash point |
313.858°C |
| Vapour Pressur |
0mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
