ChemNet > CAS > 1075-35-0 5-Chloro-2-methylindole
1075-35-0 5-Chloro-2-methylindole
| product Name |
5-Chloro-2-methylindole |
| Synonyms |
5-chloro-2-methyl-1H-indole |
| Molecular Formula |
C9H8ClN |
| Molecular Weight |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-5,11H,1H3 |
| CAS Registry Number |
1075-35-0 |
| EINECS |
214-052-9 |
| Molecular Structure |
|
| Density |
1.273g/cm3 |
| Melting point |
112-117℃ |
| Boiling point |
302.7°C at 760 mmHg |
| Refractive index |
1.663 |
| Flash point |
165.3°C |
| Vapour Pressur |
0.00175mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
