ChemNet > CAS > 1076-74-0 5-Methoxy-2-methylindole
1076-74-0 5-Methoxy-2-methylindole
| product Name |
5-Methoxy-2-methylindole |
| Synonyms |
5-methoxy-2-methyl-1H-indole |
| Molecular Formula |
C10H11NO |
| Molecular Weight |
161.2004 |
| InChI |
InChI=1/C10H11NO/c1-7-5-8-6-9(12-2)3-4-10(8)11-7/h3-6,11H,1-2H3 |
| CAS Registry Number |
1076-74-0 |
| EINECS |
214-066-5 |
| Molecular Structure |
|
| Density |
1.134g/cm3 |
| Melting point |
85-88℃ |
| Boiling point |
308.5°C at 760 mmHg |
| Refractive index |
1.621 |
| Flash point |
113.1°C |
| Vapour Pressur |
0.00123mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
