ChemNet > CAS > 108847-20-7 Dibenzothiophene-4-boronic acid
108847-20-7 Dibenzothiophene-4-boronic acid
product Name |
Dibenzothiophene-4-boronic acid |
Synonyms |
Dibenzo[b,d]thiophen-4-ylboronic acid; 4-Dibenzothienylboronic acid; 4-DIBENZOTHIOPHENEBORONIC ACID |
Molecular Formula |
C12H9BO2S |
Molecular Weight |
228.0747 |
InChI |
InChI=1/C12H9BO2S/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7,14-15H |
CAS Registry Number |
108847-20-7 |
Molecular Structure |
|
Density |
1.38g/cm3 |
Melting point |
327-330℃ |
Boiling point |
480.2°C at 760 mmHg |
Refractive index |
1.738 |
Flash point |
244.2°C |
Vapour Pressur |
4.97E-10mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S22:;
S24/25:;
|
|