ChemNet > CAS > 1119-46-6 5-Chlorovaleric acid
1119-46-6 5-Chlorovaleric acid
| product Name |
5-Chlorovaleric acid |
| Synonyms |
214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
| Molecular Formula |
C5H9ClO2 |
| Molecular Weight |
136.5768 |
| InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| CAS Registry Number |
1119-46-6 |
| EINECS |
214-279-3 |
| Molecular Structure |
|
| Density |
1.166g/cm3 |
| Melting point |
18-20℃ |
| Boiling point |
230.9°C at 760 mmHg |
| Refractive index |
1.452 |
| Flash point |
93.4°C |
| Vapour Pressur |
0.0227mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
