ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
| product Name |
Bromoiodotoluene |
| Synonyms |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
| Molecular Formula |
C7H6BrI |
| Molecular Weight |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| CAS Registry Number |
116632-39-4 |
| Molecular Structure |
|
| Density |
2.062g/cm3 |
| Boiling point |
264.2°C at 760 mmHg |
| Refractive index |
1.636 |
| Flash point |
113.6°C |
| Vapour Pressur |
0.0161mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
