ChemNet > CAS > 1195-92-2 (+)-Limonene oxide, mixture of cis and trans
1195-92-2 (+)-Limonene oxide, mixture of cis and trans
| product Name |
(+)-Limonene oxide, mixture of cis and trans |
| Synonyms |
Limonene-1,2-epoxide; 1,2-Epoxy-p-menth-8-ene; 1,2-Epoxylimonene; 1-Methyl-4-(1-methylethenyl)-7-oxabicyclo(4.1.0)heptane; AI3-24998; CCRIS 3763; Limonene 1,2-epoxide; Limonene 1,2-oxide; Limonene epoxide; Limonene monoxide; Limonene oxide; NSC 12045; (+)-Limonene oxide; 1-Methyl-4-(1-methylvinyl)-7-oxabicyclo(4.1.0)heptane; 7-Oxabicyclo(4.1.0)heptane, 1-methyl-4-(1-methylethenyl)-; p-Menth-8-ene, 1,2-epoxy-; 1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane; (4R)-1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane; (1S,4R,6R)-1-methyl-4-(prop-1-en-2-yl)-7-oxabicyclo[4.1.0]heptane; (1S,4S,6R)-1-methyl-4-(1-methylethenyl)-7-oxabicyclo[4.1.0]heptane; (1R,4R,6S)-1-methyl-4-(1-methylethenyl)-7-oxabicyclo[4.1.0]heptane |
| Molecular Formula |
C10H16O |
| Molecular Weight |
152.2334 |
| InChI |
InChI=1/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
| CAS Registry Number |
1195-92-2 |
| EINECS |
214-805-1 |
| Molecular Structure |
|
| Density |
0.972g/cm3 |
| Boiling point |
198.1°C at 760 mmHg |
| Refractive index |
1.49 |
| Flash point |
65.6°C |
| Vapour Pressur |
0.515mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
