ChemNet > CAS > 124-10-7 Methyl myristate
124-10-7 Methyl myristate
| product Name |
Methyl myristate |
| Synonyms |
Methyl tetradecanoate; methyl myristate 99%; Myristic Acid Methyl Ester; Tetradecanoic acid methyl ester |
| Molecular Formula |
C15H30O2 |
| Molecular Weight |
242.40 |
| InChI |
InChI=1/C15H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-14H2,1-2H3 |
| CAS Registry Number |
124-10-7 |
| EINECS |
204-680-1 |
| Molecular Structure |
|
| Density |
0.863 |
| Melting point |
18.4-20℃ |
| Boiling point |
323℃ |
| Refractive index |
1.434-1.438 |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
