ChemNet > CAS > 127913-44-4 (S)-(-)-4-chloro 3-hydroxybutyronitrile
127913-44-4 (S)-(-)-4-chloro 3-hydroxybutyronitrile
| product Name |
(S)-(-)-4-chloro 3-hydroxybutyronitrile |
| Synonyms |
(S)-(-)-4-Chloro-3-hydroxybutyronitrile; S-(-)-4-chloro-3-hydorxy butyronitrile; (3S)-4-chloro-3-hydorxybutyronitrile; (3R)-4-chloro-3-hydroxybutanenitrile; (3S)-4-chloro-3-hydroxybutanenitrile; S-(-)-4-Chloro-3-hydroxybutyronitrile; (S)-4-Chloro-3-hydroxybutyronitrile |
| Molecular Formula |
C4H6ClNO |
| Molecular Weight |
119.5495 |
| InChI |
InChI=1/C4H6ClNO/c5-3-4(7)1-2-6/h4,7H,1,3H2/t4-/m0/s1 |
| CAS Registry Number |
127913-44-4 |
| Molecular Structure |
|
| Density |
1.229g/cm3 |
| Boiling point |
286.2°C at 760 mmHg |
| Refractive index |
1.464 |
| Flash point |
126.9°C |
| Vapour Pressur |
0.000304mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
