ChemNet > CAS > 1300-73-8 xylidine mixture of isomers
1300-73-8 xylidine mixture of isomers
| product Name |
xylidine mixture of isomers |
| Synonyms |
Dimethylaniline mixture; Xylidines; DMA mixture; Dimethylaniline; Mix Xylidine |
| Molecular Formula |
C8H11N |
| Molecular Weight |
121.1796 |
| InChI |
InChI=1/C8H11N/c1-6-3-4-8(9)7(2)5-6/h3-5H,9H2,1-2H3 |
| CAS Registry Number |
1300-73-8 |
| EINECS |
215-091-4 |
| Molecular Structure |
|
| Density |
0.975g/cm3 |
| Boiling point |
214.7°C at 760 mmHg |
| Refractive index |
1.559 |
| Flash point |
90.6°C |
| Vapour Pressur |
0.154mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
