ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
| product Name |
4-iodo-2-methylaniline |
| Synonyms |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
| Molecular Formula |
C7H8IN |
| Molecular Weight |
233.0496 |
| InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| CAS Registry Number |
13194-68-8 |
| EINECS |
236-154-2 |
| Molecular Structure |
|
| Density |
1.791g/cm3 |
| Melting point |
86-89℃ |
| Boiling point |
278.4°C at 760 mmHg |
| Refractive index |
1.663 |
| Flash point |
122.1°C |
| Vapour Pressur |
0.00428mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
