ChemNet > CAS > 13265-84-4 D-glucal
13265-84-4 D-glucal
| product Name |
D-glucal |
| Synonyms |
1,5-Anhydro-2-deoxy-D-arabino-hex-1-enitol; D-arabino-Hex-1-enitol, 1,5-anhydro-2-deoxy-; (4xi)-1,5-anhydro-2-deoxy-D-threo-hex-1-enitol |
| Molecular Formula |
C6H10O4 |
| Molecular Weight |
146.1412 |
| InChI |
InChI=1/C6H10O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,4-9H,3H2/t4-,5-,6+/m1/s1 |
| CAS Registry Number |
13265-84-4 |
| EINECS |
236-259-3 |
| Molecular Structure |
|
| Density |
1.414g/cm3 |
| Melting point |
58-60℃ |
| Boiling point |
325.5°C at 760 mmHg |
| Refractive index |
1.565 |
| Flash point |
150.7°C |
| Vapour Pressur |
1.77E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
