ChemNet > CAS > 139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
139911-27-6 4-Fluoro-3-methylbenzeneboronic acid
| product Name |
4-Fluoro-3-methylbenzeneboronic acid |
| Synonyms |
4-Fluoro-3-methylphenylboronic acid; 4-Fluoro-m-tolylboronic acid |
| Molecular Formula |
C7H8BFO2 |
| Molecular Weight |
153.9466 |
| InChI |
InChI=1/C7H8BFO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3 |
| CAS Registry Number |
139911-27-6 |
| Molecular Structure |
|
| Density |
1.2g/cm3 |
| Melting point |
212-217℃ |
| Boiling point |
282°C at 760 mmHg |
| Refractive index |
1.505 |
| Flash point |
124.3°C |
| Vapour Pressur |
0.00163mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
