ChemNet > CAS > 1475-12-3 1-(2,5-Dichlorophenyl)ethanol
1475-12-3 1-(2,5-Dichlorophenyl)ethanol
| product Name |
1-(2,5-Dichlorophenyl)ethanol |
| Synonyms |
2,5-Dichloro-alpha-methylbenzyl alcohol~2,5-Dichlorophenyl methyl carbinol; 2,5-Dichlorophenyl Ethanol |
| Molecular Formula |
C8H8Cl2O |
| Molecular Weight |
191.0545 |
| InChI |
InChI=1/C8H8Cl2O/c1-5(11)7-4-6(9)2-3-8(7)10/h2-5,11H,1H3 |
| CAS Registry Number |
1475-12-3 |
| EINECS |
216-018-9 |
| Molecular Structure |
|
| Density |
1.323g/cm3 |
| Boiling point |
257.9°C at 760 mmHg |
| Refractive index |
1.566 |
| Flash point |
112.1°C |
| Vapour Pressur |
0.00725mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
