ChemNet > CAS > 147650-70-2 (S)-(-)-2-Piperazinecarboxylic acid
147650-70-2 (S)-(-)-2-Piperazinecarboxylic acid
| product Name |
(S)-(-)-2-Piperazinecarboxylic acid |
| Synonyms |
(S)-Piperazine-2-carboxylic acid; (2S)-piperazine-2-carboxylic acid; 2-(S)-Piperazine carboxylic acid |
| Molecular Formula |
C5H10N2O2 |
| Molecular Weight |
130.1451 |
| InChI |
InChI=1/C5H10N2O2/c8-5(9)4-3-6-1-2-7-4/h4,6-7H,1-3H2,(H,8,9)/t4-/m0/s1 |
| CAS Registry Number |
147650-70-2 |
| Molecular Structure |
|
| Density |
1.174g/cm3 |
| Boiling point |
313.6°C at 760 mmHg |
| Refractive index |
1.476 |
| Flash point |
143.5°C |
| Vapour Pressur |
0.000107mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
