ChemNet > CAS > 1501-06-0 Diethyl 2-acetylglutarate
1501-06-0 Diethyl 2-acetylglutarate
| product Name |
Diethyl 2-acetylglutarate |
| Synonyms |
2-Acetylglutaric acid diethyl ester; diethyl 2-acetylpentanedioate; diethyl (2R)-2-acetylpentanedioate; diethyl (2S)-2-acetylpentanedioate |
| Molecular Formula |
C11H18O5 |
| Molecular Weight |
230.2576 |
| InChI |
InChI=1/C11H18O5/c1-4-15-10(13)7-6-9(8(3)12)11(14)16-5-2/h9H,4-7H2,1-3H3/t9-/m0/s1 |
| CAS Registry Number |
1501-06-0 |
| EINECS |
216-114-0 |
| Molecular Structure |
|
| Density |
1.073g/cm3 |
| Boiling point |
291.2°C at 760 mmHg |
| Refractive index |
1.439 |
| Flash point |
127.5°C |
| Vapour Pressur |
0.00198mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
