ChemNet > CAS > 1516-17-2 2,4-Hexadienyl acetate
1516-17-2 2,4-Hexadienyl acetate
| product Name |
2,4-Hexadienyl acetate |
| Synonyms |
trans,trans-2,4-Hexadienyl acetate; hexa-2,4-dien-1-yl acetate; (2E,4E)-hexa-2,4-dien-1-yl acetate |
| Molecular Formula |
C8H12O2 |
| Molecular Weight |
140.1797 |
| InChI |
InChI=1/C8H12O2/c1-3-4-5-6-7-10-8(2)9/h3-6H,7H2,1-2H3/b4-3+,6-5+ |
| CAS Registry Number |
1516-17-2 |
| EINECS |
216-163-8 |
| Molecular Structure |
|
| Density |
0.926g/cm3 |
| Boiling point |
186.5°C at 760 mmHg |
| Refractive index |
1.454 |
| Flash point |
79.6°C |
| Vapour Pressur |
0.662mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36:Irritating to eyes.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
