ChemNet > CAS > 154257-75-7 3-Chloro-2,4-difluorobenzoic acid
154257-75-7 3-Chloro-2,4-difluorobenzoic acid
| product Name |
3-Chloro-2,4-difluorobenzoic acid |
| Synonyms |
1-fluoro-4-isothiocyanatobenzene; 3-chloro-2,4-difluorobenzoate; 3-Chloro-2,4-Difluoro-Benzoic Acid |
| Molecular Formula |
C7H2ClF2O2 |
| Molecular Weight |
191.5399 |
| InChI |
InChI=1/C7H3ClF2O2/c8-5-4(9)2-1-3(6(5)10)7(11)12/h1-2H,(H,11,12)/p-1 |
| CAS Registry Number |
154257-75-7 |
| EINECS |
216-280-4 |
| Molecular Structure |
|
| Boiling point |
276.7°C at 760 mmHg |
| Flash point |
121.1°C |
| Vapour Pressur |
0.00228mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
