ChemNet > CAS > 15804-19-0 2,3-Dihydroxyquinoxaline
15804-19-0 2,3-Dihydroxyquinoxaline
product Name |
2,3-Dihydroxyquinoxaline |
Synonyms |
2,3-Quinoxalinediol; 1,4-Dihydro-2,3-quinoxalinedione; quinoxaline-2,3-diol; 1,4-dihydroquinoxaline-2,3-dione |
Molecular Formula |
C8H6N2O2 |
Molecular Weight |
162.1454 |
InChI |
InChI=1/C8H6N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-4H,(H,9,11)(H,10,12) |
CAS Registry Number |
15804-19-0 |
EINECS |
239-901-0 |
Molecular Structure |
|
Density |
1.517g/cm3 |
Melting point |
300℃ |
Boiling point |
470.915°C at 760 mmHg |
Refractive index |
1.762 |
Flash point |
238.601°C |
Vapour Pressur |
0mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|