ChemNet > CAS > 1591-30-6 4,4'-Biphenyldicarbonitrile
1591-30-6 4,4'-Biphenyldicarbonitrile
product Name |
4,4'-Biphenyldicarbonitrile |
Synonyms |
4,4-Dicyanobiphenyl; biphenyl-4,4'-dicarbonitrile |
Molecular Formula |
C14H8N2 |
Molecular Weight |
204.2267 |
InChI |
InChI=1/C14H8N2/c15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h1-8H |
CAS Registry Number |
1591-30-6 |
EINECS |
216-468-6 |
Molecular Structure |
|
Density |
1.2g/cm3 |
Melting point |
236-236℃ |
Boiling point |
403.5°C at 760 mmHg |
Refractive index |
1.631 |
Flash point |
199.2°C |
Vapour Pressur |
1.02E-06mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
R20/22:Harmful by inhalation and if swallowed.;
|
Safety Description |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|