ChemNet > CAS > 15965-54-5 2-Chloro-5-methoxybenzimidazole
15965-54-5 2-Chloro-5-methoxybenzimidazole
| product Name |
2-Chloro-5-methoxybenzimidazole |
| Synonyms |
2-chloro-6-methoxy-1H-benzimidazole |
| Molecular Formula |
C8H7ClN2O |
| Molecular Weight |
182.607 |
| InChI |
InChI=1/C8H7ClN2O/c1-12-5-2-3-6-7(4-5)11-8(9)10-6/h2-4H,1H3,(H,10,11) |
| CAS Registry Number |
15965-54-5 |
| Molecular Structure |
|
| Density |
1.393g/cm3 |
| Boiling point |
365.7°C at 760 mmHg |
| Refractive index |
1.656 |
| Flash point |
175°C |
| Vapour Pressur |
1.54E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
