ChemNet > CAS > 159954-28-6 Salmon Glucoside
159954-28-6 Salmon Glucoside
| product Name |
Salmon Glucoside |
| Synonyms |
6-Chloro-3-indoxyl-beta-D-glucopyranoside; Salmon-beta-D-glucoside; 6-chloro-1H-indol-3-yl alpha-D-glucopyranoside |
| Molecular Formula |
C14H16ClNO6 |
| Molecular Weight |
329.7329 |
| InChI |
InChI=1/C14H16ClNO6/c15-6-1-2-7-8(3-6)16-4-9(7)21-14-13(20)12(19)11(18)10(5-17)22-14/h1-4,10-14,16-20H,5H2/t10-,11-,12+,13-,14+/m1/s1 |
| CAS Registry Number |
159954-28-6 |
| Molecular Structure |
|
| Density |
1.641g/cm3 |
| Boiling point |
630.2°C at 760 mmHg |
| Refractive index |
1.717 |
| Flash point |
334.9°C |
| Vapour Pressur |
9.45E-17mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
