ChemNet > CAS > 161446-90-8 3-Chloro-4-fluorobenzyl alcohol
161446-90-8 3-Chloro-4-fluorobenzyl alcohol
| product Name |
3-Chloro-4-fluorobenzyl alcohol |
| Synonyms |
(3-chloro-4-fluorophenyl)methanol; 3-Chloro-4-fluorobenzyla alcohol |
| Molecular Formula |
C7H6ClFO |
| Molecular Weight |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c8-6-3-5(4-10)1-2-7(6)9/h1-3,10H,4H2 |
| CAS Registry Number |
161446-90-8 |
| Molecular Structure |
|
| Density |
1.344g/cm3 |
| Boiling point |
242.5°C at 760 mmHg |
| Refractive index |
1.542 |
| Flash point |
100.4°C |
| Vapour Pressur |
0.0183mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
