ChemNet > CAS > 16209-00-0 4-(1H-pyrazol-1-yl)benzoic acid
16209-00-0 4-(1H-pyrazol-1-yl)benzoic acid
| product Name |
4-(1H-pyrazol-1-yl)benzoic acid |
| Synonyms |
4-(1H-pyrazol-1-yl)benzoate |
| Molecular Formula |
C10H7N2O2 |
| Molecular Weight |
187.1753 |
| InChI |
InChI=1/C10H8N2O2/c13-10(14)8-2-4-9(5-3-8)12-7-1-6-11-12/h1-7H,(H,13,14)/p-1 |
| CAS Registry Number |
16209-00-0 |
| Molecular Structure |
|
| Melting point |
272℃ |
| Boiling point |
360.4°C at 760 mmHg |
| Flash point |
171.8°C |
| Vapour Pressur |
8E-06mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
