ChemNet > CAS > 1635-31-0 3-Aminocoumarin
1635-31-0 3-Aminocoumarin
| product Name |
3-Aminocoumarin |
| Synonyms |
3-Coumarinamine; 3-amino-2H-chromen-2-one |
| Molecular Formula |
C9H7NO2 |
| Molecular Weight |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
| CAS Registry Number |
1635-31-0 |
| EINECS |
216-659-4 |
| Molecular Structure |
|
| Density |
1.313g/cm3 |
| Boiling point |
355.2°C at 760 mmHg |
| Refractive index |
1.624 |
| Flash point |
199.3°C |
| Vapour Pressur |
3.17E-05mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
