ChemNet > CAS > 1638-86-4 Diethyl phenylphosphonite
1638-86-4 Diethyl phenylphosphonite
| product Name |
Diethyl phenylphosphonite |
| Synonyms |
Diethoxyphenylphosphine; Phenylphosphonous acid diethyl ester |
| Molecular Formula |
C10H15O2P |
| Molecular Weight |
198.1987 |
| InChI |
InChI=1/C10H15O2P/c1-3-11-13(12-4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| CAS Registry Number |
1638-86-4 |
| EINECS |
216-676-7 |
| Molecular Structure |
|
| Boiling point |
235°C at 760 mmHg |
| Flash point |
113°C |
| Vapour Pressur |
0.0784mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
