ChemNet > CAS > 16518-62-0 3-Bromo-N,N-dimethylaniline
16518-62-0 3-Bromo-N,N-dimethylaniline
| product Name |
3-Bromo-N,N-dimethylaniline |
| Synonyms |
Benzenamine, 3-bromo-N,N-dimethyl-; 4-cyanophenyl benzoate; 3-bromo-N,N-dimethylbenzenamine |
| Molecular Formula |
C8H10BrN |
| Molecular Weight |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| CAS Registry Number |
16518-62-0 |
| Molecular Structure |
|
| Density |
1.393g/cm3 |
| Boiling point |
259.7°C at 760 mmHg |
| Refractive index |
1.586 |
| Flash point |
110.8°C |
| Vapour Pressur |
0.0128mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
