ChemNet > CAS > 166744-78-1 4-Benzyloxy-2-fluorobenzeneboronic acid
166744-78-1 4-Benzyloxy-2-fluorobenzeneboronic acid
product Name |
4-Benzyloxy-2-fluorobenzeneboronic acid |
Synonyms |
4-Benzyloxy-2-fluorophenylboronic acid |
Molecular Formula |
C13H12BFO3 |
Molecular Weight |
246.042 |
InChI |
InChI=1/C13H12BFO3/c15-13-8-11(6-7-12(13)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
CAS Registry Number |
166744-78-1 |
Molecular Structure |
|
Density |
1.26g/cm3 |
Melting point |
153℃ |
Boiling point |
406.8°C at 760 mmHg |
Refractive index |
1.577 |
Flash point |
199.8°C |
Vapour Pressur |
2.4E-07mmHg at 25°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|