ChemNet > CAS > 1689-64-1 9-Hydroxyfluorene
1689-64-1 9-Hydroxyfluorene
| product Name |
9-Hydroxyfluorene |
| Synonyms |
9-Fluorenol; Hydroxyfluoren; 9-Hydroxy-fluoren; 9H-fluoren-9-ol |
| Molecular Formula |
C13H10O |
| Molecular Weight |
182.2179 |
| InChI |
InChI=1/C13H10O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,13-14H |
| CAS Registry Number |
1689-64-1 |
| EINECS |
216-879-0 |
| Molecular Structure |
|
| Density |
1.253g/cm3 |
| Melting point |
153-154℃ |
| Boiling point |
367.5°C at 760 mmHg |
| Refractive index |
1.687 |
| Flash point |
131.3°C |
| Vapour Pressur |
4.76E-06mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
