ChemNet > CAS > 1730-48-9 6-Methoxy-1,2,3,4-tetrahydronaphthalene
1730-48-9 6-Methoxy-1,2,3,4-tetrahydronaphthalene
| product Name |
6-Methoxy-1,2,3,4-tetrahydronaphthalene |
| Synonyms |
methyl 1,2,3,4-tetrahydro-6-naphthyl ether; 6-Methoxytetralin |
| Molecular Formula |
C11H14O |
| Molecular Weight |
162.2283 |
| InChI |
InChI=1/C11H14O/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h6-8H,2-5H2,1H3 |
| CAS Registry Number |
1730-48-9 |
| EINECS |
217-049-0 |
| Molecular Structure |
|
| Density |
1.012g/cm3 |
| Boiling point |
278.5°C at 760 mmHg |
| Refractive index |
1.532 |
| Flash point |
105.9°C |
| Vapour Pressur |
0.0072mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
