ChemNet > CAS > 175134-98-2 N-(3-Cyanophenyl)pyrrole
175134-98-2 N-(3-Cyanophenyl)pyrrole
| product Name |
N-(3-Cyanophenyl)pyrrole |
| Synonyms |
3-(1-Pyrrolo)benzonitrile; 3-(1H-pyrrol-1-yl)benzonitrile |
| Molecular Formula |
C11H8N2 |
| Molecular Weight |
168.1946 |
| InChI |
InChI=1/C11H8N2/c12-9-10-4-3-5-11(8-10)13-6-1-2-7-13/h1-8H |
| CAS Registry Number |
175134-98-2 |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Boiling point |
306.3°C at 760 mmHg |
| Refractive index |
1.589 |
| Flash point |
139.1°C |
| Vapour Pressur |
0.000776mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
