ChemNet > CAS > 177787-26-7 3,4,5-trifluorobenzoyl chloride
177787-26-7 3,4,5-trifluorobenzoyl chloride
| product Name |
3,4,5-trifluorobenzoyl chloride |
| Molecular Formula |
C7H2ClF3O |
| Molecular Weight |
194.5384 |
| InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-4(9)6(11)5(10)2-3/h1-2H |
| CAS Registry Number |
177787-26-7 |
| Molecular Structure |
|
| Density |
1.514g/cm3 |
| Boiling point |
184.7°C at 760 mmHg |
| Refractive index |
1.479 |
| Flash point |
65.5°C |
| Vapour Pressur |
0.722mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
