ChemNet > CAS > 18355-80-1 2,3-difluoroacetophenone
18355-80-1 2,3-difluoroacetophenone
| product Name |
2,3-difluoroacetophenone |
| Synonyms |
2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
| Molecular Formula |
C8H6F2O |
| Molecular Weight |
156.1294 |
| InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| CAS Registry Number |
18355-80-1 |
| Molecular Structure |
|
| Density |
1.206g/cm3 |
| Boiling point |
193.4°C at 760 mmHg |
| Refractive index |
1.472 |
| Flash point |
71.5°C |
| Vapour Pressur |
0.465mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
