ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
| product Name |
Methyl 3-methoxyphenylacetate |
| Synonyms |
Methyl 2-(3-methoxyphenyl)acetate |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
| CAS Registry Number |
18927-05-4 |
| Molecular Structure |
|
| Density |
1.083g/cm3 |
| Boiling point |
254°C at 760 mmHg |
| Refractive index |
1.499 |
| Flash point |
100.2°C |
| Vapour Pressur |
0.0176mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
