ChemNet > CAS > 19241-19-1 2-ethylphenyl isothiocyanate
19241-19-1 2-ethylphenyl isothiocyanate
| product Name |
2-ethylphenyl isothiocyanate |
| Synonyms |
2-Ethylisothiocyanatobenzene; 1-ethyl-2-isothiocyanatobenzene |
| Molecular Formula |
C9H9NS |
| Molecular Weight |
163.2395 |
| InChI |
InChI=1/C9H9NS/c1-2-8-5-3-4-6-9(8)10-7-11/h3-6H,2H2,1H3 |
| CAS Registry Number |
19241-19-1 |
| Molecular Structure |
|
| Density |
1.01g/cm3 |
| Boiling point |
264.8°C at 760 mmHg |
| Refractive index |
1.553 |
| Flash point |
115.1°C |
| Vapour Pressur |
0.0155mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
