ChemNet > CAS > 1978-61-6 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride
1978-61-6 4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride
| product Name |
4-(4-Fluorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride |
| Molecular Formula |
C11H13FN |
| Molecular Weight |
178.2255 |
| InChI |
InChI=1/C11H12FN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2/p+1 |
| CAS Registry Number |
1978-61-6 |
| EINECS |
217-836-9 |
| Molecular Structure |
|
| Melting point |
169-173℃ |
| Boiling point |
264°C at 760 mmHg |
| Flash point |
113.4°C |
| Vapour Pressur |
0.00997mmHg at 25°C |
| Hazard Symbols |
 T:Toxic;
|
| Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
