ChemNet > CAS > 1985-12-2 4-Bromophenyl isothiocyanate
1985-12-2 4-Bromophenyl isothiocyanate
| product Name |
4-Bromophenyl isothiocyanate |
| Synonyms |
Isothiocaynic acid 4-bromophenyl ester; 4-(Isothiocyanato)-bromobenzene; 1-bromo-4-isothiocyanatobenzene |
| Molecular Formula |
C7H4BrNS |
| Molecular Weight |
214.0824 |
| InChI |
InChI=1/C7H4BrNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| CAS Registry Number |
1985-12-2 |
| Molecular Structure |
|
| Density |
1.5g/cm3 |
| Melting point |
56-58℃ |
| Boiling point |
280.1°C at 760 mmHg |
| Refractive index |
1.622 |
| Flash point |
123.2°C |
| Vapour Pressur |
0.00656mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
