ChemNet > CAS > 20469-63-0 Dimethoxyiodobenzene
20469-63-0 Dimethoxyiodobenzene
| product Name |
Dimethoxyiodobenzene |
| Synonyms |
1,3-Dimethoxy-4-iodobenzene; 1-Iodo-2,4-dimethoxybenzene; Benzene, 1-iodo-2,4-dimethoxy-; 2,4-Dimethoxyiodobenzene |
| Molecular Formula |
C8H9IO2 |
| Molecular Weight |
264.0603 |
| InChI |
InChI=1/C8H9IO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,1-2H3 |
| CAS Registry Number |
20469-63-0 |
| Molecular Structure |
|
| Density |
1.655g/cm3 |
| Melting point |
37-41℃ |
| Boiling point |
284.3°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
125.7°C |
| Vapour Pressur |
0.00515mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
