ChemNet > CAS > 206559-57-1 2,5-difluorophenyl isothiocyanate
206559-57-1 2,5-difluorophenyl isothiocyanate
| product Name |
2,5-difluorophenyl isothiocyanate |
| Synonyms |
1,4-difluoro-2-isocyanatobenzene |
| Molecular Formula |
C7H3F2NO |
| Molecular Weight |
155.1016 |
| InChI |
InChI=1/C7H3F2NO/c8-5-1-2-6(9)7(3-5)10-4-11/h1-3H |
| CAS Registry Number |
206559-57-1 |
| Molecular Structure |
|
| Density |
1.24g/cm3 |
| Boiling point |
181.1°C at 760 mmHg |
| Refractive index |
1.488 |
| Flash point |
56.1°C |
| Vapour Pressur |
0.867mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
