ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
| product Name |
3-Cyclohexene-1,1-dimethanol |
| Synonyms |
4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
| Molecular Formula |
C8H14O2 |
| Molecular Weight |
142.1956 |
| InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
| CAS Registry Number |
2160-94-3 |
| EINECS |
218-481-2 |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Melting point |
88-92℃ |
| Boiling point |
231.2°C at 760 mmHg |
| Refractive index |
1.497 |
| Flash point |
105°C |
| Vapour Pressur |
0.0119mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
