ChemNet > CAS > 220497-79-0 (R)-N-FMOC-2-Bromophenylalanine
220497-79-0 (R)-N-FMOC-2-Bromophenylalanine
product Name |
(R)-N-FMOC-2-Bromophenylalanine |
Synonyms |
Fmoc-D-2-Bromophenylalanine; Fmoc-2-Bromo-D-phenylalanine |
Molecular Formula |
C24H20BrNO4 |
Molecular Weight |
466.3239 |
InChI |
InChI=1/C24H20BrNO4/c25-21-12-6-1-7-15(21)13-22(23(27)28)26-24(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1 |
CAS Registry Number |
220497-79-0 |
Molecular Structure |
|
Density |
1.459g/cm3 |
Melting point |
158.1℃ |
Boiling point |
657.1°C at 760 mmHg |
Refractive index |
1.646 |
Flash point |
351.2°C |
Vapour Pressur |
3.66E-18mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|