ChemNet > CAS > 227958-96-5 ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate
227958-96-5 ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate
| product Name |
ethyl 4,6-dichloro-2-(methylthio)quinoline-3-carboxylate |
| Synonyms |
ethyl 4,6-dichloro-2-(methylsulfanyl)quinoline-3-carboxylate |
| Molecular Formula |
C13H11Cl2NO2S |
| Molecular Weight |
316.2029 |
| InChI |
InChI=1/C13H11Cl2NO2S/c1-3-18-13(17)10-11(15)8-6-7(14)4-5-9(8)16-12(10)19-2/h4-6H,3H2,1-2H3 |
| CAS Registry Number |
227958-96-5 |
| Molecular Structure |
|
| Density |
1.42g/cm3 |
| Melting point |
133℃ |
| Boiling point |
410.2°C at 760 mmHg |
| Refractive index |
1.643 |
| Flash point |
201.9°C |
| Vapour Pressur |
6.12E-07mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
