ChemNet > CAS > 23147-58-2 glycolaldehyde dimer, mixture of stereoisomers
23147-58-2 glycolaldehyde dimer, mixture of stereoisomers
product Name |
glycolaldehyde dimer, mixture of stereoisomers |
Synonyms |
Glycolaldehyde dimer; Hydroxy Acetaldehyde; 1,4-dioxane-2,5-diol; 2,5-Dihydroxy-1,4-dioxane |
Molecular Formula |
C4H8O4 |
Molecular Weight |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 |
CAS Registry Number |
23147-58-2 |
Molecular Structure |
|
Density |
1.455g/cm3 |
Melting point |
85℃ |
Boiling point |
312.4°C at 760 mmHg |
Refractive index |
1.513 |
Flash point |
142.8°C |
Vapour Pressur |
4.65E-05mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
|
|