ChemNet > CAS > 2454-37-7 3-(1-Hydroxyethyl)aniline
2454-37-7 3-(1-Hydroxyethyl)aniline
| product Name |
3-(1-Hydroxyethyl)aniline |
| Synonyms |
1-(3-Aminophenyl)ethanol; 3-Amino-alpha-methylbenzyl alcohol~3-Aminophenyl methyl carbinol~3-(alpha-Hydroxyethyl)aniline; (1R)-1-(3-aminophenyl)ethanol; (1S)-1-(3-aminophenyl)ethanol |
| Molecular Formula |
C8H11NO |
| Molecular Weight |
137.179 |
| InChI |
InChI=1/C8H11NO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,9H2,1H3/t6-/m0/s1 |
| CAS Registry Number |
2454-37-7 |
| EINECS |
219-525-3 |
| Molecular Structure |
|
| Density |
1.117g/cm3 |
| Melting point |
66-70℃ |
| Boiling point |
285°C at 760 mmHg |
| Refractive index |
1.592 |
| Flash point |
126.1°C |
| Vapour Pressur |
0.00135mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
