ChemNet > CAS > 24864-19-5 4-(4-Biphenylyl)-2-methylthiazole
24864-19-5 4-(4-Biphenylyl)-2-methylthiazole
product Name |
4-(4-Biphenylyl)-2-methylthiazole |
Synonyms |
4-(4-Biphenylyl)-2-methyl-1,3-thiazole; 4-(biphenyl-4-yl)-2-methyl-1,3-thiazole |
Molecular Formula |
C16H13NS |
Molecular Weight |
251.3461 |
InChI |
InChI=1/C16H13NS/c1-12-17-16(11-18-12)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-11H,1H3 |
CAS Registry Number |
24864-19-5 |
EINECS |
246-505-1 |
Molecular Structure |
|
Density |
1.147g/cm3 |
Melting point |
113-118℃ |
Boiling point |
431.3°C at 760 mmHg |
Refractive index |
1.618 |
Flash point |
218.3°C |
Vapour Pressur |
3.05E-07mmHg at 25°C |
Hazard Symbols |
|
Risk Codes |
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|